C16H19N3O6 — CID 154782627
4-[[5-cyano-2-(2-methoxyethoxy)phenyl]carbamoyl]morpholine-2-carboxylic acid (PubChem CID 154782627) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is 4-[[5-cyano-2-(2-methoxyethoxy)phenyl]carbamoyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[[5-cyano-2-(2-methoxyethoxy)phenyl]carbamoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 154782627 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-[[5-cyano-2-(2-methoxyethoxy)phenyl]carbamoyl]morpholine-2-carboxylic acid |
| SMILES | COCCOc1ccc(C#N)cc1NC(=O)N1CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C16H19N3O6/c1-23-6-7-25-13-3-2-11(9-17)8-12(13)18-16(22)19-4-5-24-14(10-19)15(20)21/h2-3,8,14H,4-7,10H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | MHMTXFDTOXTMFK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|