About 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone
1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone (PubChem CID 154783014) has the molecular formula C17H20ClN3O
and a molecular weight of 317.82 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone |
| PubChem CID | 154783014 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone |
| SMILES | CC1(C)C(c2ccccc2Cl)CCN1C(=O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C17H20ClN3O/c1-17(2)14(13-5-3-4-6-15(13)18)7-8-21(17)16(22)9-12-10-19-11-20-12/h3-6,10-11,14H,7-9H2,1-2H3,(H,19,20) |
| InChIKey | SYHOORBDXRPFLT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone?
The IUPAC name of 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone (CID 154783014) is 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone.
What is the SMILES notation for 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone?
The canonical SMILES for 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone is CC1(C)C(c2ccccc2Cl)CCN1C(=O)Cc1cnc[nH]1.
What is the InChIKey of 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone?
The InChIKey is SYHOORBDXRPFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O/c1-17(2)14(13-5-3-4-6-15(13)18)7-8-21(17)16(22)9-12-10-19-11-20-12/h3-6,10-11,14H,7-9H2,1-2H3,(H,19,20).
What are the key properties of 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone?
1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone has a molecular weight of 317.82 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]-2-(1H-imidazol-5-yl)ethanone is sourced from PubChem (CID 154783014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).