C17H24N4O2 — CID 154784126
6,6-dimethyl-N-[[(2R,5S)-5-(1H-1,2,4-triazol-5-yl)oxolan-2-yl]methyl]-5,7-dihydro-4H-1-benzofuran-4-amine (PubChem CID 154784126) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6,6-dimethyl-N-[[(2R,5S)-5-(1H-1,2,4-triazol-5-yl)oxolan-2-yl]methyl]-5,7-dihydro-4H-1-benzofuran-4-amine.
| Compound Name | 6,6-dimethyl-N-[[(2R,5S)-5-(1H-1,2,4-triazol-5-yl)oxolan-2-yl]methyl]-5,7-dihydro-4H-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 154784126 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 6,6-dimethyl-N-[[(2R,5S)-5-(1H-1,2,4-triazol-5-yl)oxolan-2-yl]methyl]-5,7-dihydro-4H-1-benzofuran-4-amine |
| SMILES | CC1(C)Cc2occc2C(NC[C@H]2CC[C@@H](c3ncn[nH]3)O2)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-17(2)7-13(12-5-6-22-15(12)8-17)18-9-11-3-4-14(23-11)16-19-10-20-21-16/h5-6,10-11,13-14,18H,3-4,7-9H2,1-2H3,(H,19,20,21)/t11-,13?,14+/m1/s1 |
| InChIKey | OURBBUWIGNNCKE-VFXSIBAZSA-N |
| XLogP | 2.92 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |