C21H26FN5O2 — CID 154784273
2-fluoro-3-methyl-N-[[2-methyl-4-(6-methyl-2-pyridin-4-ylpyrimidin-4-yl)morpholin-2-yl]methyl]but-2-enamide (PubChem CID 154784273) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-[[2-methyl-4-(6-methyl-2-pyridin-4-ylpyrimidin-4-yl)morpholin-2-yl]methyl]but-2-enamide.
| Compound Name | 2-fluoro-3-methyl-N-[[2-methyl-4-(6-methyl-2-pyridin-4-ylpyrimidin-4-yl)morpholin-2-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 154784273 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-fluoro-3-methyl-N-[[2-methyl-4-(6-methyl-2-pyridin-4-ylpyrimidin-4-yl)morpholin-2-yl]methyl]but-2-enamide |
| SMILES | CC(C)=C(F)C(=O)NCC1(C)CN(c2cc(C)nc(-c3ccncc3)n2)CCO1 |
| InChI | InChI=1S/C21H26FN5O2/c1-14(2)18(22)20(28)24-12-21(4)13-27(9-10-29-21)17-11-15(3)25-19(26-17)16-5-7-23-8-6-16/h5-8,11H,9-10,12-13H2,1-4H3,(H,24,28) |
| InChIKey | BBWYVBWWNJDFFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|