C7H10N6S2 — CID 154784455
N-(2-methylsulfanylethyl)-5-(1,2,5-thiadiazol-3-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 154784455) has the molecular formula C7H10N6S2 and a molecular weight of 242.33 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-5-(1,2,5-thiadiazol-3-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(2-methylsulfanylethyl)-5-(1,2,5-thiadiazol-3-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 154784455 |
| Molecular Formula | C7H10N6S2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | N-(2-methylsulfanylethyl)-5-(1,2,5-thiadiazol-3-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CSCCNc1n[nH]c(-c2cnsn2)n1 |
| InChI | InChI=1S/C7H10N6S2/c1-14-3-2-8-7-10-6(11-12-7)5-4-9-15-13-5/h4H,2-3H2,1H3,(H2,8,10,11,12) |
| InChIKey | OYMSAGGOMGGKMR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|