C19H33N5 — CID 154785117
3-ethyl-N-(4-methyl-4-pyrrolidin-1-ylcyclohexyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 154785117) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is 3-ethyl-N-(4-methyl-4-pyrrolidin-1-ylcyclohexyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-ethyl-N-(4-methyl-4-pyrrolidin-1-ylcyclohexyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 154785117 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 3-ethyl-N-(4-methyl-4-pyrrolidin-1-ylcyclohexyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | CCc1nnc2n1CC(NC1CCC(C)(N3CCCC3)CC1)CC2 |
| InChI | InChI=1S/C19H33N5/c1-3-17-21-22-18-7-6-16(14-24(17)18)20-15-8-10-19(2,11-9-15)23-12-4-5-13-23/h15-16,20H,3-14H2,1-2H3 |
| InChIKey | PXEMTTZNZCRICU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |