C17H20F2N4O2 — CID 154786025
(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-[2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanone (PubChem CID 154786025) has the molecular formula C17H20F2N4O2 and a molecular weight of 350.37 g/mol. Its IUPAC name is (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-[2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanone.
| Compound Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-[2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanone |
|---|---|
| PubChem CID | 154786025 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-[2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanone |
| SMILES | O=C(N1CCC=C(F)C1)C12CCOCC1CN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C17H20F2N4O2/c18-13-2-1-4-22(9-13)15(24)17-3-5-25-10-12(17)8-23(11-17)16-20-6-14(19)7-21-16/h2,6-7,12H,1,3-5,8-11H2 |
| InChIKey | MBGGKTQNNFNCAO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |