C11H8BrN3O4 — CID 154786154
3-[[3-(5-bromofuran-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 154786154) has the molecular formula C11H8BrN3O4 and a molecular weight of 326.11 g/mol. Its IUPAC name is 3-[[3-(5-bromofuran-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[[3-(5-bromofuran-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154786154 |
| Molecular Formula | C11H8BrN3O4 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 3-[[3-(5-bromofuran-2-yl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cc2nc(-c3ccc(Br)o3)no2)C(=O)N1 |
| InChI | InChI=1S/C11H8BrN3O4/c12-7-2-1-6(18-7)10-14-9(19-15-10)4-5-3-8(16)13-11(5)17/h1-2,5H,3-4H2,(H,13,16,17) |
| InChIKey | AWNMXYAGDLWFCL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|