C19H27N5O4 — CID 154786835
methyl 4-[[1-(2-oxopiperidine-4-carbonyl)azocan-3-yl]amino]pyrimidine-2-carboxylate (PubChem CID 154786835) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is methyl 4-[[1-(2-oxopiperidine-4-carbonyl)azocan-3-yl]amino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-[[1-(2-oxopiperidine-4-carbonyl)azocan-3-yl]amino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 154786835 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | methyl 4-[[1-(2-oxopiperidine-4-carbonyl)azocan-3-yl]amino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NC2CCCCCN(C(=O)C3CCNC(=O)C3)C2)n1 |
| InChI | InChI=1S/C19H27N5O4/c1-28-19(27)17-21-9-7-15(23-17)22-14-5-3-2-4-10-24(12-14)18(26)13-6-8-20-16(25)11-13/h7,9,13-14H,2-6,8,10-12H2,1H3,(H,20,25)(H,21,22,23) |
| InChIKey | PDQCIAHLXGTPNP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |