About 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one
4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one (PubChem CID 154787003) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one.
Molecular Properties
| Compound Name | 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one |
| PubChem CID | 154787003 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one |
| SMILES | COc1cccc2c1CCC2(N)C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C15H19N3O3/c1-21-12-4-2-3-11-10(12)5-6-15(11,16)14(20)18-8-7-17-13(19)9-18/h2-4H,5-9,16H2,1H3,(H,17,19) |
| InChIKey | WANXBIUIVKONID-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one?
The IUPAC name of 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one (CID 154787003) is 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one.
What is the SMILES notation for 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one?
The canonical SMILES for 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one is COc1cccc2c1CCC2(N)C(=O)N1CCNC(=O)C1.
What is the InChIKey of 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one?
The InChIKey is WANXBIUIVKONID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-21-12-4-2-3-11-10(12)5-6-15(11,16)14(20)18-8-7-17-13(19)9-18/h2-4H,5-9,16H2,1H3,(H,17,19).
What are the key properties of 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one?
4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one has a molecular weight of 289.33 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one is sourced from PubChem (CID 154787003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).