C15H19N3O3 — CID 154787003
4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one (PubChem CID 154787003) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one.
| Compound Name | 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 154787003 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(1-amino-4-methoxy-2,3-dihydroindene-1-carbonyl)piperazin-2-one |
| SMILES | COc1cccc2c1CCC2(N)C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C15H19N3O3/c1-21-12-4-2-3-11-10(12)5-6-15(11,16)14(20)18-8-7-17-13(19)9-18/h2-4H,5-9,16H2,1H3,(H,17,19) |
| InChIKey | WANXBIUIVKONID-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |