C23H30O8 — CID 15478704
dimethyl (1S,2S,3S,5R,6R,9S,10R,12R)-3,5-dihydroxy-12-methoxy-3-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-7,13-diene-7,13-dicarboxylate (PubChem CID 15478704) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is dimethyl (1S,2S,3S,5R,6R,9S,10R,12R)-3,5-dihydroxy-12-methoxy-3-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-7,13-diene-7,13-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3S,5R,6R,9S,10R,12R)-3,5-dihydroxy-12-methoxy-3-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-7,13-diene-7,13-dicarboxylate |
|---|---|
| PubChem CID | 15478704 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | dimethyl (1S,2S,3S,5R,6R,9S,10R,12R)-3,5-dihydroxy-12-methoxy-3-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-7,13-diene-7,13-dicarboxylate |
| SMILES | C=C(C)[C@@H]1C[C@@]2(OC)O[C@@]3(C=C2C(=O)OC)[C@H]2[C@H](C(C(=O)OC)=C[C@@H]13)[C@H](O)C[C@]2(C)O |
| InChI | InChI=1S/C23H30O8/c1-11(2)13-8-23(30-6)15(20(26)29-5)9-22(31-23)14(13)7-12(19(25)28-4)17-16(24)10-21(3,27)18(17)22/h7,9,13-14,16-18,24,27H,1,8,10H2,2-6H3/t13-,14-,16+,17+,18-,21-,22+,23+/m0/s1 |
| InChIKey | PTMUIPNQECHBJB-FCJAQJRRSA-N |
| XLogP | 1.27 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|