About N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine
N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine (PubChem CID 154787671) has the molecular formula C13H21N5O
and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine |
| PubChem CID | 154787671 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine |
| SMILES | c1c(CNC2CCCCC2)nnn1CC1=NOCC1 |
| InChI | InChI=1S/C13H21N5O/c1-2-4-11(5-3-1)14-8-13-10-18(17-15-13)9-12-6-7-19-16-12/h10-11,14H,1-9H2 |
| InChIKey | AFSKILHHQIFBED-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine?
The IUPAC name of N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine (CID 154787671) is N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine.
What is the SMILES notation for N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine?
The canonical SMILES for N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine is c1c(CNC2CCCCC2)nnn1CC1=NOCC1.
What is the InChIKey of N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine?
The InChIKey is AFSKILHHQIFBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O/c1-2-4-11(5-3-1)14-8-13-10-18(17-15-13)9-12-6-7-19-16-12/h10-11,14H,1-9H2.
What are the key properties of N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine?
N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine has a molecular weight of 263.34 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(4,5-dihydro-1,2-oxazol-3-ylmethyl)triazol-4-yl]methyl]cyclohexanamine is sourced from PubChem (CID 154787671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).