C16H18ClFN2O3 — CID 154787704
(3aR,7aR)-2-(6-chloro-3-fluoro-2-methylbenzoyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide (PubChem CID 154787704) has the molecular formula C16H18ClFN2O3 and a molecular weight of 340.78 g/mol. Its IUPAC name is (3aR,7aR)-2-(6-chloro-3-fluoro-2-methylbenzoyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide.
| Compound Name | (3aR,7aR)-2-(6-chloro-3-fluoro-2-methylbenzoyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide |
|---|---|
| PubChem CID | 154787704 |
| Molecular Formula | C16H18ClFN2O3 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (3aR,7aR)-2-(6-chloro-3-fluoro-2-methylbenzoyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide |
| SMILES | Cc1c(F)ccc(Cl)c1C(=O)N1C[C@@H]2COCC[C@]2(C(N)=O)C1 |
| InChI | InChI=1S/C16H18ClFN2O3/c1-9-12(18)3-2-11(17)13(9)14(21)20-6-10-7-23-5-4-16(10,8-20)15(19)22/h2-3,10H,4-8H2,1H3,(H2,19,22)/t10-,16+/m1/s1 |
| InChIKey | GIRRWOUGLQNETI-HWPZZCPQSA-N |
| XLogP | 1.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |