About methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate
methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate (PubChem CID 15478789) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate |
| PubChem CID | 15478789 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate |
| SMILES | COC(=O)NC1(C)c2ccc(OC)nc2CCC1OC |
| InChI | InChI=1S/C14H20N2O4/c1-14(16-13(17)20-4)9-5-8-12(19-3)15-10(9)6-7-11(14)18-2/h5,8,11H,6-7H2,1-4H3,(H,16,17) |
| InChIKey | RZTYHDZQJXRYDK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate?
The IUPAC name of methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate (CID 15478789) is methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate.
What is the SMILES notation for methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate?
The canonical SMILES for methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate is COC(=O)NC1(C)c2ccc(OC)nc2CCC1OC.
What is the InChIKey of methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate?
The InChIKey is RZTYHDZQJXRYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-14(16-13(17)20-4)9-5-8-12(19-3)15-10(9)6-7-11(14)18-2/h5,8,11H,6-7H2,1-4H3,(H,16,17).
What are the key properties of methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate?
methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate has a molecular weight of 280.32 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,6-dimethoxy-5-methyl-7,8-dihydro-6H-quinolin-5-yl)carbamate is sourced from PubChem (CID 15478789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).