C18H28O11 — CID 154790908
methyl (4aS,8aS)-3-methoxy-1-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,8,8a-hexahydropyrano[3,4-c]pyran-5-carboxylate (PubChem CID 154790908) has the molecular formula C18H28O11 and a molecular weight of 420.41 g/mol. Its IUPAC name is methyl (4aS,8aS)-3-methoxy-1-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,8,8a-hexahydropyrano[3,4-c]pyran-5-carboxylate.
| Compound Name | methyl (4aS,8aS)-3-methoxy-1-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,8,8a-hexahydropyrano[3,4-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 154790908 |
| Molecular Formula | C18H28O11 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | methyl (4aS,8aS)-3-methoxy-1-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,4,4a,8,8a-hexahydropyrano[3,4-c]pyran-5-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)[C@@H]2C(C)OC(OC)C[C@H]12 |
| InChI | InChI=1S/C18H28O11/c1-7-12-8(4-11(24-2)27-7)9(16(23)25-3)6-26-17(12)29-18-15(22)14(21)13(20)10(5-19)28-18/h6-8,10-15,17-22H,4-5H2,1-3H3/t7?,8-,10?,11?,12-,13?,14?,15?,17?,18?/m1/s1 |
| InChIKey | IZODPOCIKVLNIL-XLAMMYBCSA-N |
| XLogP | -1.77 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |