C13H20O3 — CID 15479314
2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid (PubChem CID 15479314) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid.
| Compound Name | 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid |
|---|---|
| PubChem CID | 15479314 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[(1S,2S,4R)-1-ethenyl-2-hydroxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]acetic acid |
| SMILES | C=C[C@]12CC[C@H](C[C@]1(O)CC(=O)O)C2(C)C |
| InChI | InChI=1S/C13H20O3/c1-4-12-6-5-9(11(12,2)3)7-13(12,16)8-10(14)15/h4,9,16H,1,5-8H2,2-3H3,(H,14,15)/t9-,12-,13+/m1/s1 |
| InChIKey | XHHLHBOEIZDWSN-WQAKAFBOSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|