C10H15F3N2O2 — CID 154793372
N-methyl-N-[2-oxo-2-(1,1,1-trifluorobutan-2-ylamino)ethyl]prop-2-enamide (PubChem CID 154793372) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(1,1,1-trifluorobutan-2-ylamino)ethyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2-oxo-2-(1,1,1-trifluorobutan-2-ylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154793372 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(1,1,1-trifluorobutan-2-ylamino)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)NC(CC)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O2/c1-4-7(10(11,12)13)14-8(16)6-15(3)9(17)5-2/h5,7H,2,4,6H2,1,3H3,(H,14,16) |
| InChIKey | YDVKGEMQXRBOGU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|