C20H24N2O3 — CID 154793714
1-[3-(3,4-diethoxyphenyl)phenyl]-1,3-diazinan-2-one (PubChem CID 154793714) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[3-(3,4-diethoxyphenyl)phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-(3,4-diethoxyphenyl)phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 154793714 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[3-(3,4-diethoxyphenyl)phenyl]-1,3-diazinan-2-one |
| SMILES | CCOc1ccc(-c2cccc(N3CCCNC3=O)c2)cc1OCC |
| InChI | InChI=1S/C20H24N2O3/c1-3-24-18-10-9-16(14-19(18)25-4-2)15-7-5-8-17(13-15)22-12-6-11-21-20(22)23/h5,7-10,13-14H,3-4,6,11-12H2,1-2H3,(H,21,23) |
| InChIKey | PKFYKWSUBXNSQK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |