C16H22N4O3 — CID 154793765
methyl (E)-5-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]pent-2-enoate (PubChem CID 154793765) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is methyl (E)-5-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 154793765 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | methyl (E)-5-[(3-cyclopropyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-6-carbonyl)amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)C1CCc2nnc(C3CC3)n2C1 |
| InChI | InChI=1S/C16H22N4O3/c1-23-14(21)4-2-3-9-17-16(22)12-7-8-13-18-19-15(11-5-6-11)20(13)10-12/h2,4,11-12H,3,5-10H2,1H3,(H,17,22)/b4-2+ |
| InChIKey | DLKQOERFDWSNTF-DUXPYHPUSA-N |
| XLogP | 0.95 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|