C17H17F4N3O — CID 154794401
6-methyl-N-[4-(1,2,2,2-tetrafluoroethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 154794401) has the molecular formula C17H17F4N3O and a molecular weight of 355.34 g/mol. Its IUPAC name is 6-methyl-N-[4-(1,2,2,2-tetrafluoroethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-methyl-N-[4-(1,2,2,2-tetrafluoroethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154794401 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 6-methyl-N-[4-(1,2,2,2-tetrafluoroethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC1CCc2nc(C(=O)Nc3ccc(C(F)C(F)(F)F)cc3)cn2C1 |
| InChI | InChI=1S/C17H17F4N3O/c1-10-2-7-14-23-13(9-24(14)8-10)16(25)22-12-5-3-11(4-6-12)15(18)17(19,20)21/h3-6,9-10,15H,2,7-8H2,1H3,(H,22,25) |
| InChIKey | FEFNFGPMGSKMSJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |