About [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone
[2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone (PubChem CID 154794770) has the molecular formula C15H13ClF2N2O2
and a molecular weight of 326.73 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone |
| PubChem CID | 154794770 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone |
| SMILES | O=C(c1coc(-c2ccccc2Cl)n1)N1CC(CC(F)F)C1 |
| InChI | InChI=1S/C15H13ClF2N2O2/c16-11-4-2-1-3-10(11)14-19-12(8-22-14)15(21)20-6-9(7-20)5-13(17)18/h1-4,8-9,13H,5-7H2 |
| InChIKey | XLHSXCJGISRURX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone?
The IUPAC name of [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone (CID 154794770) is [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone.
What is the SMILES notation for [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone?
The canonical SMILES for [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone is O=C(c1coc(-c2ccccc2Cl)n1)N1CC(CC(F)F)C1.
What is the InChIKey of [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone?
The InChIKey is XLHSXCJGISRURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF2N2O2/c16-11-4-2-1-3-10(11)14-19-12(8-22-14)15(21)20-6-9(7-20)5-13(17)18/h1-4,8-9,13H,5-7H2.
What are the key properties of [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone?
[2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone has a molecular weight of 326.73 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-1,3-oxazol-4-yl]-[3-(2,2-difluoroethyl)azetidin-1-yl]methanone is sourced from PubChem (CID 154794770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).