C21H31N7O — CID 154795035
N,N,4,5-tetramethyl-6-[(3R)-3-[(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]pyrrolidin-1-yl]pyrimidine-2-carboxamide (PubChem CID 154795035) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is N,N,4,5-tetramethyl-6-[(3R)-3-[(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]pyrrolidin-1-yl]pyrimidine-2-carboxamide.
| Compound Name | N,N,4,5-tetramethyl-6-[(3R)-3-[(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]pyrrolidin-1-yl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 154795035 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N,N,4,5-tetramethyl-6-[(3R)-3-[(2-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]pyrrolidin-1-yl]pyrimidine-2-carboxamide |
| SMILES | Cc1nc(C(=O)N(C)C)nc(N2CC[C@@H](NC3CCCc4nn(C)cc43)C2)c1C |
| InChI | InChI=1S/C21H31N7O/c1-13-14(2)22-19(21(29)26(3)4)24-20(13)28-10-9-15(11-28)23-17-7-6-8-18-16(17)12-27(5)25-18/h12,15,17,23H,6-11H2,1-5H3/t15-,17?/m1/s1 |
| InChIKey | KOTQBQNZKZOXAV-LDCVWXEPSA-N |
| XLogP | 1.77 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |