About N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide
N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 154795092) has the molecular formula C14H22F2N2O2
and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
| PubChem CID | 154795092 |
| Molecular Formula | C14H22F2N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N(C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H22F2N2O2/c1-4-12(19)18(5-2)10-13(20)17(3)11-6-8-14(15,16)9-7-11/h4,11H,1,5-10H2,2-3H3 |
| InChIKey | IAMRGNNRMDYNED-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide?
The IUPAC name of N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide (CID 154795092) is N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide.
What is the SMILES notation for N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide?
The canonical SMILES for N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide is C=CC(=O)N(CC)CC(=O)N(C)C1CCC(F)(F)CC1.
What is the InChIKey of N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide?
The InChIKey is IAMRGNNRMDYNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2O2/c1-4-12(19)18(5-2)10-13(20)17(3)11-6-8-14(15,16)9-7-11/h4,11H,1,5-10H2,2-3H3.
What are the key properties of N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide?
N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide has a molecular weight of 288.34 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,4-difluorocyclohexyl)-methylamino]-2-oxoethyl]-N-ethylprop-2-enamide is sourced from PubChem (CID 154795092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).