About 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one
5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one (PubChem CID 154795224) has the molecular formula C16H21N5O2S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one.
Molecular Properties
| Compound Name | 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one |
| PubChem CID | 154795224 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one |
| SMILES | O=C1CCC(Cn2cc(-c3csc(N4CCCCCC4)n3)nn2)O1 |
| InChI | InChI=1S/C16H21N5O2S/c22-15-6-5-12(23-15)9-21-10-13(18-19-21)14-11-24-16(17-14)20-7-3-1-2-4-8-20/h10-12H,1-9H2 |
| InChIKey | WEVAYUXWRASDAN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one?
The IUPAC name of 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one (CID 154795224) is 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one.
What is the SMILES notation for 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one?
The canonical SMILES for 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one is O=C1CCC(Cn2cc(-c3csc(N4CCCCCC4)n3)nn2)O1.
What is the InChIKey of 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one?
The InChIKey is WEVAYUXWRASDAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O2S/c22-15-6-5-12(23-15)9-21-10-13(18-19-21)14-11-24-16(17-14)20-7-3-1-2-4-8-20/h10-12H,1-9H2.
What are the key properties of 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one?
5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one has a molecular weight of 347.44 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[2-(azepan-1-yl)-1,3-thiazol-4-yl]triazol-1-yl]methyl]oxolan-2-one is sourced from PubChem (CID 154795224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).