C18H27F3N4O2 — CID 154795571
(4aR,7aS)-5-oxo-N-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide (PubChem CID 154795571) has the molecular formula C18H27F3N4O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is (4aR,7aS)-5-oxo-N-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide.
| Compound Name | (4aR,7aS)-5-oxo-N-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 154795571 |
| Molecular Formula | C18H27F3N4O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (4aR,7aS)-5-oxo-N-[3-[4-(trifluoromethyl)piperidin-1-yl]cyclobutyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
| SMILES | O=C1NC[C@@H]2[C@H]1CCCN2C(=O)NC1CC(N2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C18H27F3N4O2/c19-18(20,21)11-3-6-24(7-4-11)13-8-12(9-13)23-17(27)25-5-1-2-14-15(25)10-22-16(14)26/h11-15H,1-10H2,(H,22,26)(H,23,27)/t12?,13?,14-,15-/m1/s1 |
| InChIKey | ZPOKXPBAUPEBBB-NEXFUWMNSA-N |
| XLogP | 1.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |