C15H21N7O2S — CID 154795632
3-cyclopentyl-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide (PubChem CID 154795632) has the molecular formula C15H21N7O2S and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-cyclopentyl-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide.
| Compound Name | 3-cyclopentyl-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154795632 |
| Molecular Formula | C15H21N7O2S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-cyclopentyl-N-(5-methoxy-1,3,4-thiadiazol-2-yl)-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxamide |
| SMILES | COc1nnc(NC(=O)N2CCn3c(C4CCCC4)nnc3C2C)s1 |
| InChI | InChI=1S/C15H21N7O2S/c1-9-11-17-18-12(10-5-3-4-6-10)22(11)8-7-21(9)14(23)16-13-19-20-15(24-2)25-13/h9-10H,3-8H2,1-2H3,(H,16,19,23) |
| InChIKey | GADKKLIIHNSPAL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |