About (2R,4S)-2-methyloxan-4-amine;hydrochloride
(2R,4S)-2-methyloxan-4-amine;hydrochloride (PubChem CID 154796566) has the molecular formula C6H14ClNO
and a molecular weight of 151.64 g/mol. Its IUPAC name is (2R,4S)-2-methyloxan-4-amine;hydrochloride.
Molecular Properties
| Compound Name | (2R,4S)-2-methyloxan-4-amine;hydrochloride |
| PubChem CID | 154796566 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (2R,4S)-2-methyloxan-4-amine;hydrochloride |
| SMILES | C[C@@H]1C[C@@H](N)CCO1.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-5-4-6(7)2-3-8-5;/h5-6H,2-4,7H2,1H3;1H/t5-,6+;/m1./s1 |
| InChIKey | AVADPQZSGFARIV-IBTYICNHSA-N |
| XLogP | 0.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4S)-2-methyloxan-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-methyloxan-4-amine;hydrochloride?
The IUPAC name of (2R,4S)-2-methyloxan-4-amine;hydrochloride (CID 154796566) is (2R,4S)-2-methyloxan-4-amine;hydrochloride.
What is the SMILES notation for (2R,4S)-2-methyloxan-4-amine;hydrochloride?
The canonical SMILES for (2R,4S)-2-methyloxan-4-amine;hydrochloride is C[C@@H]1C[C@@H](N)CCO1.Cl.
What is the InChIKey of (2R,4S)-2-methyloxan-4-amine;hydrochloride?
The InChIKey is AVADPQZSGFARIV-IBTYICNHSA-N. The full InChI is InChI=1S/C6H13NO.ClH/c1-5-4-6(7)2-3-8-5;/h5-6H,2-4,7H2,1H3;1H/t5-,6+;/m1./s1.
What are the key properties of (2R,4S)-2-methyloxan-4-amine;hydrochloride?
(2R,4S)-2-methyloxan-4-amine;hydrochloride has a molecular weight of 151.64 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-methyloxan-4-amine;hydrochloride is sourced from PubChem (CID 154796566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).