C15H14N4O2 — CID 154796639
(3-ethynylmorpholin-4-yl)-[2-(1H-imidazol-2-yl)-4-pyridinyl]methanone (PubChem CID 154796639) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3-ethynylmorpholin-4-yl)-[2-(1H-imidazol-2-yl)-4-pyridinyl]methanone.
| Compound Name | (3-ethynylmorpholin-4-yl)-[2-(1H-imidazol-2-yl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 154796639 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (3-ethynylmorpholin-4-yl)-[2-(1H-imidazol-2-yl)-4-pyridinyl]methanone |
| SMILES | C#CC1COCCN1C(=O)c1ccnc(-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C15H14N4O2/c1-2-12-10-21-8-7-19(12)15(20)11-3-4-16-13(9-11)14-17-5-6-18-14/h1,3-6,9,12H,7-8,10H2,(H,17,18) |
| InChIKey | YWZFSSLGFPXVBH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|