C18H17FN2O3 — CID 154796734
N-[1-[4-[(4-fluorobenzoyl)amino]phenyl]ethyl]oxirane-2-carboxamide (PubChem CID 154796734) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is N-[1-[4-[(4-fluorobenzoyl)amino]phenyl]ethyl]oxirane-2-carboxamide.
| Compound Name | N-[1-[4-[(4-fluorobenzoyl)amino]phenyl]ethyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 154796734 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[1-[4-[(4-fluorobenzoyl)amino]phenyl]ethyl]oxirane-2-carboxamide |
| SMILES | CC(NC(=O)C1CO1)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-11(20-18(23)16-10-24-16)12-4-8-15(9-5-12)21-17(22)13-2-6-14(19)7-3-13/h2-9,11,16H,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | DVXIXDJQTPFDFI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|