About [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol
[4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol (PubChem CID 154797001) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol |
| PubChem CID | 154797001 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol |
| SMILES | COc1ccc2c(c1)OCCC2Nc1cc(C)nc(CO)n1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-7-15(19-16(9-20)17-10)18-13-5-6-22-14-8-11(21-2)3-4-12(13)14/h3-4,7-8,13,20H,5-6,9H2,1-2H3,(H,17,18,19) |
| InChIKey | HRFWYGNDTZDARX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol?
The IUPAC name of [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol (CID 154797001) is [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol.
What is the SMILES notation for [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol?
The canonical SMILES for [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol is COc1ccc2c(c1)OCCC2Nc1cc(C)nc(CO)n1.
What is the InChIKey of [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol?
The InChIKey is HRFWYGNDTZDARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-10-7-15(19-16(9-20)17-10)18-13-5-6-22-14-8-11(21-2)3-4-12(13)14/h3-4,7-8,13,20H,5-6,9H2,1-2H3,(H,17,18,19).
What are the key properties of [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol?
[4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol has a molecular weight of 301.35 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(7-methoxy-3,4-dihydro-2H-chromen-4-yl)amino]-6-methylpyrimidin-2-yl]methanol is sourced from PubChem (CID 154797001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).