About 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole
4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole (PubChem CID 154797167) has the molecular formula C13H8N4S2
and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole |
| PubChem CID | 154797167 |
| Molecular Formula | C13H8N4S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole |
| SMILES | c1cc2nc(-c3csc(-c4ccsc4)n3)[nH]c2cn1 |
| InChI | InChI=1S/C13H8N4S2/c1-3-14-5-10-9(1)15-12(16-10)11-7-19-13(17-11)8-2-4-18-6-8/h1-7H,(H,15,16) |
| InChIKey | AUGZEKJQAWSZNR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole?
The IUPAC name of 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole (CID 154797167) is 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole.
What is the SMILES notation for 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole?
The canonical SMILES for 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole is c1cc2nc(-c3csc(-c4ccsc4)n3)[nH]c2cn1.
What is the InChIKey of 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole?
The InChIKey is AUGZEKJQAWSZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4S2/c1-3-14-5-10-9(1)15-12(16-10)11-7-19-13(17-11)8-2-4-18-6-8/h1-7H,(H,15,16).
What are the key properties of 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole?
4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole has a molecular weight of 284.37 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3H-imidazo[4,5-c]pyridin-2-yl)-2-thiophen-3-yl-1,3-thiazole is sourced from PubChem (CID 154797167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).