About [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone
[(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone (PubChem CID 154798375) has the molecular formula C13H19BrN2OS
and a molecular weight of 331.28 g/mol. Its IUPAC name is [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone |
| PubChem CID | 154798375 |
| Molecular Formula | C13H19BrN2OS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@@H](C)[C@](C)(CN)C2)sc1Br |
| InChI | InChI=1S/C13H19BrN2OS/c1-8-4-10(18-11(8)14)12(17)16-5-9(2)13(3,6-15)7-16/h4,9H,5-7,15H2,1-3H3/t9-,13-/m1/s1 |
| InChIKey | FEWYIUMCLDWVNM-NOZJJQNGSA-N |
| XLogP | 2.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone?
The IUPAC name of [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone (CID 154798375) is [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone.
What is the SMILES notation for [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone?
The canonical SMILES for [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone is Cc1cc(C(=O)N2C[C@@H](C)[C@](C)(CN)C2)sc1Br.
What is the InChIKey of [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone?
The InChIKey is FEWYIUMCLDWVNM-NOZJJQNGSA-N. The full InChI is InChI=1S/C13H19BrN2OS/c1-8-4-10(18-11(8)14)12(17)16-5-9(2)13(3,6-15)7-16/h4,9H,5-7,15H2,1-3H3/t9-,13-/m1/s1.
What are the key properties of [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone?
[(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone has a molecular weight of 331.28 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-(aminomethyl)-3,4-dimethylpyrrolidin-1-yl]-(5-bromo-4-methylthiophen-2-yl)methanone is sourced from PubChem (CID 154798375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).