C31H38O8 — CID 15479843
[(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-1',11'-diacetyloxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] benzoate (PubChem CID 15479843) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-1',11'-diacetyloxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] benzoate.
| Compound Name | [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-1',11'-diacetyloxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] benzoate |
|---|---|
| PubChem CID | 15479843 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [(1'R,2S,3'E,5'R,7'S,11'R,12'R,13'S,14'S)-1',11'-diacetyloxy-3',6',6',14'-tetramethyl-2'-oxospiro[oxirane-2,10'-tricyclo[10.3.0.05,7]pentadec-3-ene]-13'-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@@H](OC(=O)c3ccccc3)[C@@H](C)C[C@]2(OC(C)=O)C(=O)/C(C)=C/[C@@H]2[C@H](CC[C@]13CO3)C2(C)C |
| InChI | InChI=1S/C31H38O8/c1-17-14-23-22(29(23,5)6)12-13-30(16-36-30)27(37-19(3)32)24-25(38-28(35)21-10-8-7-9-11-21)18(2)15-31(24,26(17)34)39-20(4)33/h7-11,14,18,22-25,27H,12-13,15-16H2,1-6H3/b17-14+/t18-,22-,23+,24+,25-,27+,30-,31+/m0/s1 |
| InChIKey | SWZRPMGMXIIIOC-QBBSFLMLSA-N |
| XLogP | 4.45 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|