C14H24N4O2S — CID 154798972
2-[2-(dimethylamino)ethylsulfanyl]-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]ethanone (PubChem CID 154798972) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanyl]-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanyl]-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154798972 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanyl]-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1nc(C2CCCCN2C(=O)CSCCN(C)C)no1 |
| InChI | InChI=1S/C14H24N4O2S/c1-11-15-14(16-20-11)12-6-4-5-7-18(12)13(19)10-21-9-8-17(2)3/h12H,4-10H2,1-3H3 |
| InChIKey | YLKRFAXVWHCWKS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|