C15H21N5O2 — CID 154799872
5-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 154799872) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154799872 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-[1-(3,6-dimethylpyrazin-2-yl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cnc(C)c(N2CCC(C3(C)NC(=O)NC3=O)CC2)n1 |
| InChI | InChI=1S/C15H21N5O2/c1-9-8-16-10(2)12(17-9)20-6-4-11(5-7-20)15(3)13(21)18-14(22)19-15/h8,11H,4-7H2,1-3H3,(H2,18,19,21,22) |
| InChIKey | JOADYDRKISBJBC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|