About 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone
4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone (PubChem CID 154799932) has the molecular formula C19H28N4O2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone |
| PubChem CID | 154799932 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone |
| SMILES | CC(C)N1CCN(C2CCN(C(=O)c3cc4occc4[nH]3)CC2)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-14(2)21-8-10-22(11-9-21)15-3-6-23(7-4-15)19(24)17-13-18-16(20-17)5-12-25-18/h5,12-15,20H,3-4,6-11H2,1-2H3 |
| InChIKey | JRIJUPDWFFRVML-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone?
The IUPAC name of 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone (CID 154799932) is 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone.
What is the SMILES notation for 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone?
The canonical SMILES for 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone is CC(C)N1CCN(C2CCN(C(=O)c3cc4occc4[nH]3)CC2)CC1.
What is the InChIKey of 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone?
The InChIKey is JRIJUPDWFFRVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O2/c1-14(2)21-8-10-22(11-9-21)15-3-6-23(7-4-15)19(24)17-13-18-16(20-17)5-12-25-18/h5,12-15,20H,3-4,6-11H2,1-2H3.
What are the key properties of 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone?
4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone has a molecular weight of 344.46 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrol-5-yl-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 154799932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).