About 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol
1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol (PubChem CID 154800047) has the molecular formula C19H22ClNO3S
and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol |
| PubChem CID | 154800047 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol |
| SMILES | CC(O)(CN1CCc2cc(Cl)ccc2C1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-19(22,16-4-7-18(8-5-16)25(2,23)24)13-21-10-9-14-11-17(20)6-3-15(14)12-21/h3-8,11,22H,9-10,12-13H2,1-2H3 |
| InChIKey | QJXUZZMTSJIPCY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol?
The IUPAC name of 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol (CID 154800047) is 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol.
What is the SMILES notation for 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol?
The canonical SMILES for 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol is CC(O)(CN1CCc2cc(Cl)ccc2C1)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol?
The InChIKey is QJXUZZMTSJIPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClNO3S/c1-19(22,16-4-7-18(8-5-16)25(2,23)24)13-21-10-9-14-11-17(20)6-3-15(14)12-21/h3-8,11,22H,9-10,12-13H2,1-2H3.
What are the key properties of 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol?
1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol has a molecular weight of 379.91 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-(4-methylsulfonylphenyl)propan-2-ol is sourced from PubChem (CID 154800047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).