About 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile
3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile (PubChem CID 154800415) has the molecular formula C15H17N5O
and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile |
| PubChem CID | 154800415 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1N[C@@H]1CC(Cn2ccnc2)C[C@H]1O |
| InChI | InChI=1S/C15H17N5O/c16-7-12-1-2-17-8-14(12)19-13-5-11(6-15(13)21)9-20-4-3-18-10-20/h1-4,8,10-11,13,15,19,21H,5-6,9H2/t11?,13-,15-/m1/s1 |
| InChIKey | MSDXVKILIISYOD-IIWDCPNDSA-N |
| XLogP | 1.40 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile?
The IUPAC name of 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile (CID 154800415) is 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile.
What is the SMILES notation for 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile?
The canonical SMILES for 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile is N#Cc1ccncc1N[C@@H]1CC(Cn2ccnc2)C[C@H]1O.
What is the InChIKey of 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile?
The InChIKey is MSDXVKILIISYOD-IIWDCPNDSA-N. The full InChI is InChI=1S/C15H17N5O/c16-7-12-1-2-17-8-14(12)19-13-5-11(6-15(13)21)9-20-4-3-18-10-20/h1-4,8,10-11,13,15,19,21H,5-6,9H2/t11?,13-,15-/m1/s1.
What are the key properties of 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile?
3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile has a molecular weight of 283.33 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]amino]pyridine-4-carbonitrile is sourced from PubChem (CID 154800415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).