C18H15N5O4S — CID 154800440
1-methyl-4-nitro-N-[3-(pyridine-3-carbonyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]pyrazole-3-carboxamide (PubChem CID 154800440) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-[3-(pyridine-3-carbonyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-4-nitro-N-[3-(pyridine-3-carbonyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154800440 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-methyl-4-nitro-N-[3-(pyridine-3-carbonyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]pyrazole-3-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)Nc2sc3c(c2C(=O)c2cccnc2)CCC3)n1 |
| InChI | InChI=1S/C18H15N5O4S/c1-22-9-12(23(26)27)15(21-22)17(25)20-18-14(11-5-2-6-13(11)28-18)16(24)10-4-3-7-19-8-10/h3-4,7-9H,2,5-6H2,1H3,(H,20,25) |
| InChIKey | YHDVQQBQQUVTQN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|