About N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide
N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide (PubChem CID 154800742) has the molecular formula C11H20N4O4S
and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide |
| PubChem CID | 154800742 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide |
| SMILES | Cn1cc(O[C@@H]2CN(CCNS(C)(=O)=O)C[C@H]2O)cn1 |
| InChI | InChI=1S/C11H20N4O4S/c1-14-6-9(5-12-14)19-11-8-15(7-10(11)16)4-3-13-20(2,17)18/h5-6,10-11,13,16H,3-4,7-8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | JWRWAFMOSXLWCF-GHMZBOCLSA-N |
| XLogP | -1.61 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide (CID 154800742) is N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide is Cn1cc(O[C@@H]2CN(CCNS(C)(=O)=O)C[C@H]2O)cn1.
What is the InChIKey of N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide?
The InChIKey is JWRWAFMOSXLWCF-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H20N4O4S/c1-14-6-9(5-12-14)19-11-8-15(7-10(11)16)4-3-13-20(2,17)18/h5-6,10-11,13,16H,3-4,7-8H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide?
N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide has a molecular weight of 304.37 g/mol, XLogP of -1.61, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3R,4R)-3-hydroxy-4-(1-methylpyrazol-4-yl)oxypyrrolidin-1-yl]ethyl]methanesulfonamide is sourced from PubChem (CID 154800742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).