C15H20N6O — CID 154800962
1-(5-methyl-1H-pyrazol-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea (PubChem CID 154800962) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(5-methyl-1H-pyrazol-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 154800962 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-3-yl)-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2ccnc(N3CCCC3)c2)n[nH]1 |
| InChI | InChI=1S/C15H20N6O/c1-11-8-13(20-19-11)18-15(22)17-10-12-4-5-16-14(9-12)21-6-2-3-7-21/h4-5,8-9H,2-3,6-7,10H2,1H3,(H3,17,18,19,20,22) |
| InChIKey | JSZPPZWYGRFRDN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |