C20H23F2N3O2 — CID 154801319
[(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[5-(difluoromethyl)-1-(2-methylphenyl)pyrazol-4-yl]methanone (PubChem CID 154801319) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[5-(difluoromethyl)-1-(2-methylphenyl)pyrazol-4-yl]methanone.
| Compound Name | [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[5-(difluoromethyl)-1-(2-methylphenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 154801319 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(3aS,6aR)-3,3-dimethyl-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrol-1-yl]-[5-(difluoromethyl)-1-(2-methylphenyl)pyrazol-4-yl]methanone |
| SMILES | Cc1ccccc1-n1ncc(C(=O)N2CC(C)(C)[C@@H]3COC[C@@H]32)c1C(F)F |
| InChI | InChI=1S/C20H23F2N3O2/c1-12-6-4-5-7-15(12)25-17(18(21)22)13(8-23-25)19(26)24-11-20(2,3)14-9-27-10-16(14)24/h4-8,14,16,18H,9-11H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | HXMOLVQADYDNBA-ZBFHGGJFSA-N |
| XLogP | 3.62 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |