C15H19N3O3S3 — CID 154801340
1-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea (PubChem CID 154801340) has the molecular formula C15H19N3O3S3 and a molecular weight of 385.54 g/mol. Its IUPAC name is 1-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea.
| Compound Name | 1-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 154801340 |
| Molecular Formula | C15H19N3O3S3 |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 1-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea |
| SMILES | Cc1ncsc1CCNC(=O)N[C@H]1C[C@H](C)S(=O)(=O)c2sccc21 |
| InChI | InChI=1S/C15H19N3O3S3/c1-9-7-12(11-4-6-22-14(11)24(9,20)21)18-15(19)16-5-3-13-10(2)17-8-23-13/h4,6,8-9,12H,3,5,7H2,1-2H3,(H2,16,18,19)/t9-,12-/m0/s1 |
| InChIKey | RIKDOXCRFULPQP-CABZTGNLSA-N |
| XLogP | 2.66 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |