C16H22N4O2S — CID 154802223
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N,2-dimethyl-3-oxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 154802223) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N,2-dimethyl-3-oxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N,2-dimethyl-3-oxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 154802223 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N,2-dimethyl-3-oxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CCc1nc(CN(C)C(=O)c2c3n(c(=O)n2C)CCCC3)cs1 |
| InChI | InChI=1S/C16H22N4O2S/c1-4-13-17-11(10-23-13)9-18(2)15(21)14-12-7-5-6-8-20(12)16(22)19(14)3/h10H,4-9H2,1-3H3 |
| InChIKey | DDEZOIVULNCRCA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |