C22H18F4N2O4 — CID 15480270
6-O-tert-butyl 2-O-(2,3,5,6-tetrafluorophenyl) 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate (PubChem CID 15480270) has the molecular formula C22H18F4N2O4 and a molecular weight of 450.39 g/mol. Its IUPAC name is 6-O-tert-butyl 2-O-(2,3,5,6-tetrafluorophenyl) 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 2-O-(2,3,5,6-tetrafluorophenyl) 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 15480270 |
| Molecular Formula | C22H18F4N2O4 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 6-O-tert-butyl 2-O-(2,3,5,6-tetrafluorophenyl) 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c1ccc1[nH]c(C(=O)Oc3c(F)c(F)cc(F)c3F)cc21 |
| InChI | InChI=1S/C22H18F4N2O4/c1-22(2,3)32-21(30)28-7-6-10-11-8-15(27-14(11)4-5-16(10)28)20(29)31-19-17(25)12(23)9-13(24)18(19)26/h4-5,8-9,27H,6-7H2,1-3H3 |
| InChIKey | IOJUMJHLFYJDAS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|