About 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole
2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole (PubChem CID 154802902) has the molecular formula C15H11N7O3S
and a molecular weight of 369.37 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole |
| PubChem CID | 154802902 |
| Molecular Formula | C15H11N7O3S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole |
| SMILES | CC(Sc1ncnc2nc[nH]c12)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C15H11N7O3S/c1-8(26-15-11-12(17-6-16-11)18-7-19-15)13-20-21-14(25-13)9-2-4-10(5-3-9)22(23)24/h2-8H,1H3,(H,16,17,18,19) |
| InChIKey | HKVUPJLFXBKDOU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole?
The IUPAC name of 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole (CID 154802902) is 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole?
The canonical SMILES for 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole is CC(Sc1ncnc2nc[nH]c12)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1.
What is the InChIKey of 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole?
The InChIKey is HKVUPJLFXBKDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N7O3S/c1-8(26-15-11-12(17-6-16-11)18-7-19-15)13-20-21-14(25-13)9-2-4-10(5-3-9)22(23)24/h2-8H,1H3,(H,16,17,18,19).
What are the key properties of 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole?
2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole has a molecular weight of 369.37 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-5-[1-(7H-purin-6-ylsulfanyl)ethyl]-1,3,4-oxadiazole is sourced from PubChem (CID 154802902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).