About sodium;5,5-diphenylimidazolidine-2,4-dione;hydride
sodium;5,5-diphenylimidazolidine-2,4-dione;hydride (PubChem CID 154804358) has the molecular formula C15H13N2NaO2
and a molecular weight of 276.27 g/mol. Its IUPAC name is sodium;5,5-diphenylimidazolidine-2,4-dione;hydride.
Molecular Properties
| Compound Name | sodium;5,5-diphenylimidazolidine-2,4-dione;hydride |
| PubChem CID | 154804358 |
| Molecular Formula | C15H13N2NaO2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | sodium;5,5-diphenylimidazolidine-2,4-dione;hydride |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1.[H-].[Na+] |
| InChI | InChI=1S/C15H12N2O2.Na.H/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H,(H2,16,17,18,19);;/q;+1;-1 |
| InChIKey | KSSGQHLSRQERKS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze sodium;5,5-diphenylimidazolidine-2,4-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5,5-diphenylimidazolidine-2,4-dione;hydride?
The IUPAC name of sodium;5,5-diphenylimidazolidine-2,4-dione;hydride (CID 154804358) is sodium;5,5-diphenylimidazolidine-2,4-dione;hydride.
What is the SMILES notation for sodium;5,5-diphenylimidazolidine-2,4-dione;hydride?
The canonical SMILES for sodium;5,5-diphenylimidazolidine-2,4-dione;hydride is O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1.[H-].[Na+].
What is the InChIKey of sodium;5,5-diphenylimidazolidine-2,4-dione;hydride?
The InChIKey is KSSGQHLSRQERKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2.Na.H/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H,(H2,16,17,18,19);;/q;+1;-1.
What are the key properties of sodium;5,5-diphenylimidazolidine-2,4-dione;hydride?
sodium;5,5-diphenylimidazolidine-2,4-dione;hydride has a molecular weight of 276.27 g/mol, XLogP of -1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5,5-diphenylimidazolidine-2,4-dione;hydride is sourced from PubChem (CID 154804358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).