C31H20N4O11S2 — CID 154804546
4,5-dinitro-9-oxofluorene-2,7-disulfonic acid;quinoline (PubChem CID 154804546) has the molecular formula C31H20N4O11S2 and a molecular weight of 688.65 g/mol. Its IUPAC name is 4,5-dinitro-9-oxofluorene-2,7-disulfonic acid;quinoline.
| Compound Name | 4,5-dinitro-9-oxofluorene-2,7-disulfonic acid;quinoline |
|---|---|
| PubChem CID | 154804546 |
| Molecular Formula | C31H20N4O11S2 |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 688.06 |
| IUPAC Name | 4,5-dinitro-9-oxofluorene-2,7-disulfonic acid;quinoline |
| SMILES | O=C1c2cc(S(=O)(=O)O)cc([N+](=O)[O-])c2-c2c1cc(S(=O)(=O)O)cc2[N+](=O)[O-].c1ccc2ncccc2c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H6N2O11S2.2C9H7N/c16-13-7-1-5(27(21,22)23)3-9(14(17)18)11(7)12-8(13)2-6(28(24,25)26)4-10(12)15(19)20;2*1-2-6-9-8(4-1)5-3-7-10-9/h1-4H,(H,21,22,23)(H,24,25,26);2*1-7H |
| InChIKey | GEOJRSLFDOOUMV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 237.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|