About (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride
(2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride (PubChem CID 154804783) has the molecular formula C9H16ClF2NO2
and a molecular weight of 243.68 g/mol. Its IUPAC name is (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride |
| PubChem CID | 154804783 |
| Molecular Formula | C9H16ClF2NO2 |
| Molecular Weight | 243.68 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride |
| SMILES | Cl.N[C@H](CC1CCC(F)(F)CC1)C(=O)O |
| InChI | InChI=1S/C9H15F2NO2.ClH/c10-9(11)3-1-6(2-4-9)5-7(12)8(13)14;/h6-7H,1-5,12H2,(H,13,14);1H/t7-;/m1./s1 |
| InChIKey | MAJOAEKSMAWTQS-OGFXRTJISA-N |
| XLogP | 2.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride?
The IUPAC name of (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride (CID 154804783) is (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride.
What is the SMILES notation for (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride?
The canonical SMILES for (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride is Cl.N[C@H](CC1CCC(F)(F)CC1)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride?
The InChIKey is MAJOAEKSMAWTQS-OGFXRTJISA-N. The full InChI is InChI=1S/C9H15F2NO2.ClH/c10-9(11)3-1-6(2-4-9)5-7(12)8(13)14;/h6-7H,1-5,12H2,(H,13,14);1H/t7-;/m1./s1.
What are the key properties of (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride?
(2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride has a molecular weight of 243.68 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(4,4-difluorocyclohexyl)propanoic acid;hydrochloride is sourced from PubChem (CID 154804783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).