About 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one
3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one (PubChem CID 15480528) has the molecular formula C19H20N6O
and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one |
| PubChem CID | 15480528 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one |
| SMILES | CCn1c(=O)[nH]c2cc3c(NCc4ccc(NC)cc4)ncnc3cc21 |
| InChI | InChI=1S/C19H20N6O/c1-3-25-17-9-15-14(8-16(17)24-19(25)26)18(23-11-22-15)21-10-12-4-6-13(20-2)7-5-12/h4-9,11,20H,3,10H2,1-2H3,(H,24,26)(H,21,22,23) |
| InChIKey | QCTNGDVTDXAJGS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one?
The IUPAC name of 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one (CID 15480528) is 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one.
What is the SMILES notation for 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one?
The canonical SMILES for 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one is CCn1c(=O)[nH]c2cc3c(NCc4ccc(NC)cc4)ncnc3cc21.
What is the InChIKey of 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one?
The InChIKey is QCTNGDVTDXAJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6O/c1-3-25-17-9-15-14(8-16(17)24-19(25)26)18(23-11-22-15)21-10-12-4-6-13(20-2)7-5-12/h4-9,11,20H,3,10H2,1-2H3,(H,24,26)(H,21,22,23).
What are the key properties of 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one?
3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one has a molecular weight of 348.41 g/mol, XLogP of 2.95, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-8-[[4-(methylamino)phenyl]methylamino]-1H-imidazo[4,5-g]quinazolin-2-one is sourced from PubChem (CID 15480528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).